C14H13N — CID 171371673
15-azatetracyclo[8.5.0.02,7.011,13]pentadeca-1(10),2,4,6,8-pentaene (PubChem CID 171371673) has the molecular formula C14H13N and a molecular weight of 195.27 g/mol. Its IUPAC name is 15-azatetracyclo[8.5.0.02,7.011,13]pentadeca-1(10),2,4,6,8-pentaene.
| Compound Name | 15-azatetracyclo[8.5.0.02,7.011,13]pentadeca-1(10),2,4,6,8-pentaene |
|---|---|
| PubChem CID | 171371673 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 15-azatetracyclo[8.5.0.02,7.011,13]pentadeca-1(10),2,4,6,8-pentaene |
| SMILES | c1ccc2c3c(ccc2c1)C1CC1CN3 |
| InChI | InChI=1S/C14H13N/c1-2-4-11-9(3-1)5-6-12-13-7-10(13)8-15-14(11)12/h1-6,10,13,15H,7-8H2 |
| InChIKey | GGGQIACABWGFBV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |