C21H19FN7O5S- — CID 171399404
6-[[5-(ethoxycarbamoyl)-4-[4-ethynyl-5-fluoro-2-[methyl(sulfinato)amino]anilino]-2-pyridinyl]amino]-2-oxo-1H-pyrimidine (PubChem CID 171399404) has the molecular formula C21H19FN7O5S- and a molecular weight of 500.49 g/mol. Its IUPAC name is 6-[[5-(ethoxycarbamoyl)-4-[4-ethynyl-5-fluoro-2-[methyl(sulfinato)amino]anilino]-2-pyridinyl]amino]-2-oxo-1H-pyrimidine.
| Compound Name | 6-[[5-(ethoxycarbamoyl)-4-[4-ethynyl-5-fluoro-2-[methyl(sulfinato)amino]anilino]-2-pyridinyl]amino]-2-oxo-1H-pyrimidine |
|---|---|
| PubChem CID | 171399404 |
| Molecular Formula | C21H19FN7O5S- |
| Molecular Weight | 500.49 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 6-[[5-(ethoxycarbamoyl)-4-[4-ethynyl-5-fluoro-2-[methyl(sulfinato)amino]anilino]-2-pyridinyl]amino]-2-oxo-1H-pyrimidine |
| SMILES | C#Cc1cc(N(C)S(=O)[O-])c(Nc2cc(Nc3ccnc(=O)[nH]3)ncc2C(=O)NOCC)cc1F |
| InChI | InChI=1S/C21H20FN7O5S/c1-4-12-8-17(29(3)35(32)33)16(9-14(12)22)25-15-10-19(26-18-6-7-23-21(31)27-18)24-11-13(15)20(30)28-34-5-2/h1,6-11H,5H2,2-3H3,(H,28,30)(H,32,33)(H3,23,24,25,26,27,31)/p-1 |
| InChIKey | PPVLLFDAULGGAJ-UHFFFAOYSA-M |
| XLogP | 1.68 |
| TPSA | 164.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.49 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|