C21H36N10O3 — CID 171442621
2-(2-amino-6-oxo-1H-purin-9-yl)-N-[(4R)-1-(diaminomethylideneamino)-6-methyl-5-oxoheptan-4-yl]-N-[2-(propan-2-ylamino)ethyl]acetamide (PubChem CID 171442621) has the molecular formula C21H36N10O3 and a molecular weight of 476.59 g/mol. Its IUPAC name is 2-(2-amino-6-oxo-1H-purin-9-yl)-N-[(4R)-1-(diaminomethylideneamino)-6-methyl-5-oxoheptan-4-yl]-N-[2-(propan-2-ylamino)ethyl]acetamide.
| Compound Name | 2-(2-amino-6-oxo-1H-purin-9-yl)-N-[(4R)-1-(diaminomethylideneamino)-6-methyl-5-oxoheptan-4-yl]-N-[2-(propan-2-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 171442621 |
| Molecular Formula | C21H36N10O3 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | 2-(2-amino-6-oxo-1H-purin-9-yl)-N-[(4R)-1-(diaminomethylideneamino)-6-methyl-5-oxoheptan-4-yl]-N-[2-(propan-2-ylamino)ethyl]acetamide |
| SMILES | CC(C)NCCN(C(=O)Cn1cnc2c(=O)[nH]c(N)nc21)[C@H](CCCN=C(N)N)C(=O)C(C)C |
| InChI | InChI=1S/C21H36N10O3/c1-12(2)17(33)14(6-5-7-26-20(22)23)31(9-8-25-13(3)4)15(32)10-30-11-27-16-18(30)28-21(24)29-19(16)34/h11-14,25H,5-10H2,1-4H3,(H4,22,23,26)(H3,24,28,29,34)/t14-/m1/s1 |
| InChIKey | JJJQQOJWJJGAHP-CQSZACIVSA-N |
| XLogP | -0.82 |
| TPSA | 203.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|