C17H26O2 — CID 171483639
1-tert-butyl-4-(3,3-diethoxyprop-1-enyl)benzene (PubChem CID 171483639) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 1-tert-butyl-4-(3,3-diethoxyprop-1-enyl)benzene.
| Compound Name | 1-tert-butyl-4-(3,3-diethoxyprop-1-enyl)benzene |
|---|---|
| PubChem CID | 171483639 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 1-tert-butyl-4-(3,3-diethoxyprop-1-enyl)benzene |
| SMILES | CCOC(C=Cc1ccc(C(C)(C)C)cc1)OCC |
| InChI | InChI=1S/C17H26O2/c1-6-18-16(19-7-2)13-10-14-8-11-15(12-9-14)17(3,4)5/h8-13,16H,6-7H2,1-5H3 |
| InChIKey | JFWDJASLKNQSRO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|