C19H17BN2O4S — CID 171526641
[3-hydroxy-4-[4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]phenyl]boronic acid (PubChem CID 171526641) has the molecular formula C19H17BN2O4S and a molecular weight of 380.23 g/mol. Its IUPAC name is [3-hydroxy-4-[4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]phenyl]boronic acid.
| Compound Name | [3-hydroxy-4-[4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 171526641 |
| Molecular Formula | C19H17BN2O4S |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [3-hydroxy-4-[4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]phenyl]boronic acid |
| SMILES | O=c1[nH]c(-c2ccc(-c3ccc(B(O)O)cc3O)cc2)nc2c1CSCC2 |
| InChI | InChI=1S/C19H17BN2O4S/c23-17-9-13(20(25)26)5-6-14(17)11-1-3-12(4-2-11)18-21-16-7-8-27-10-15(16)19(24)22-18/h1-6,9,23,25-26H,7-8,10H2,(H,21,22,24) |
| InChIKey | VWEXBMXSWAZQKF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|