C25H27BN2O3S — CID 171526650
2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one (PubChem CID 171526650) has the molecular formula C25H27BN2O3S and a molecular weight of 446.38 g/mol. Its IUPAC name is 2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one.
| Compound Name | 2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 171526650 |
| Molecular Formula | C25H27BN2O3S |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(-c4nc5c(c(=O)[nH]4)CSCC5)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C25H27BN2O3S/c1-24(2)25(3,4)31-26(30-24)19-11-9-17(10-12-19)16-5-7-18(8-6-16)22-27-21-13-14-32-15-20(21)23(29)28-22/h5-12H,13-15H2,1-4H3,(H,27,28,29) |
| InChIKey | APDNLTUIJUUBCO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|