C13H11BF2N2O3S — CID 171526825
[2,6-difluoro-4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]boronic acid (PubChem CID 171526825) has the molecular formula C13H11BF2N2O3S and a molecular weight of 324.12 g/mol. Its IUPAC name is [2,6-difluoro-4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]boronic acid.
| Compound Name | [2,6-difluoro-4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 171526825 |
| Molecular Formula | C13H11BF2N2O3S |
| Molecular Weight | 324.12 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | [2,6-difluoro-4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]boronic acid |
| SMILES | O=c1[nH]c(-c2cc(F)c(B(O)O)c(F)c2)nc2c1CSCC2 |
| InChI | InChI=1S/C13H11BF2N2O3S/c15-8-3-6(4-9(16)11(8)14(20)21)12-17-10-1-2-22-5-7(10)13(19)18-12/h3-4,20-21H,1-2,5H2,(H,17,18,19) |
| InChIKey | WABCLNATGOEXGL-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.12 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|