C14H12BN3O3S — CID 171526729
[3-cyano-4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]boronic acid (PubChem CID 171526729) has the molecular formula C14H12BN3O3S and a molecular weight of 313.15 g/mol. Its IUPAC name is [3-cyano-4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]boronic acid.
| Compound Name | [3-cyano-4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 171526729 |
| Molecular Formula | C14H12BN3O3S |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | [3-cyano-4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]boronic acid |
| SMILES | N#Cc1cc(B(O)O)ccc1-c1nc2c(c(=O)[nH]1)CSCC2 |
| InChI | InChI=1S/C14H12BN3O3S/c16-6-8-5-9(15(20)21)1-2-10(8)13-17-12-3-4-22-7-11(12)14(19)18-13/h1-2,5,20-21H,3-4,7H2,(H,17,18,19) |
| InChIKey | WMSGCVKOLGGAPW-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|