C18H16BN3O3S — CID 171526748
[6-[4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]-3-pyridinyl]boronic acid (PubChem CID 171526748) has the molecular formula C18H16BN3O3S and a molecular weight of 365.22 g/mol. Its IUPAC name is [6-[4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]-3-pyridinyl]boronic acid.
| Compound Name | [6-[4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 171526748 |
| Molecular Formula | C18H16BN3O3S |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | [6-[4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]-3-pyridinyl]boronic acid |
| SMILES | O=c1[nH]c(-c2ccc(-c3ccc(B(O)O)cn3)cc2)nc2c1CSCC2 |
| InChI | InChI=1S/C18H16BN3O3S/c23-18-14-10-26-8-7-16(14)21-17(22-18)12-3-1-11(2-4-12)15-6-5-13(9-20-15)19(24)25/h1-6,9,24-25H,7-8,10H2,(H,21,22,23) |
| InChIKey | RIHBLCBMKFBURI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|