C31H46FN5O — CID 171539866
N-[4-[1-[2-[ethyl-[2-(3-fluoro-N-propylanilino)ethyl]amino]-4-pyridinyl]piperidin-4-yl]butyl]-N-methylprop-2-enamide (PubChem CID 171539866) has the molecular formula C31H46FN5O and a molecular weight of 523.74 g/mol. Its IUPAC name is N-[4-[1-[2-[ethyl-[2-(3-fluoro-N-propylanilino)ethyl]amino]-4-pyridinyl]piperidin-4-yl]butyl]-N-methylprop-2-enamide.
| Compound Name | N-[4-[1-[2-[ethyl-[2-(3-fluoro-N-propylanilino)ethyl]amino]-4-pyridinyl]piperidin-4-yl]butyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 171539866 |
| Molecular Formula | C31H46FN5O |
| Molecular Weight | 523.74 g/mol |
| Exact Mass | 523.37 |
| IUPAC Name | N-[4-[1-[2-[ethyl-[2-(3-fluoro-N-propylanilino)ethyl]amino]-4-pyridinyl]piperidin-4-yl]butyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)CCCCC1CCN(c2ccnc(N(CC)CCN(CCC)c3cccc(F)c3)c2)CC1 |
| InChI | InChI=1S/C31H46FN5O/c1-5-18-36(28-13-10-12-27(32)24-28)23-22-35(7-3)30-25-29(14-17-33-30)37-20-15-26(16-21-37)11-8-9-19-34(4)31(38)6-2/h6,10,12-14,17,24-26H,2,5,7-9,11,15-16,18-23H2,1,3-4H3 |
| InChIKey | LTQJCKSFFZHRAR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 42.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.74 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|