C24H27F2N5O3 — CID 171541249
3-[2,6-difluoro-4-[(2R,3S)-2-methyl-3-[(5-spiro[3.3]heptan-2-yl-1,3,4-oxadiazol-2-yl)amino]azetidin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 171541249) has the molecular formula C24H27F2N5O3 and a molecular weight of 471.51 g/mol. Its IUPAC name is 3-[2,6-difluoro-4-[(2R,3S)-2-methyl-3-[(5-spiro[3.3]heptan-2-yl-1,3,4-oxadiazol-2-yl)amino]azetidin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2,6-difluoro-4-[(2R,3S)-2-methyl-3-[(5-spiro[3.3]heptan-2-yl-1,3,4-oxadiazol-2-yl)amino]azetidin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171541249 |
| Molecular Formula | C24H27F2N5O3 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 3-[2,6-difluoro-4-[(2R,3S)-2-methyl-3-[(5-spiro[3.3]heptan-2-yl-1,3,4-oxadiazol-2-yl)amino]azetidin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | C[C@@H]1[C@@H](Nc2nnc(C3CC4(CCC4)C3)o2)CN1c1cc(F)c(C2CCC(=O)NC2=O)c(F)c1 |
| InChI | InChI=1S/C24H27F2N5O3/c1-12-18(27-23-30-29-22(34-23)13-9-24(10-13)5-2-6-24)11-31(12)14-7-16(25)20(17(26)8-14)15-3-4-19(32)28-21(15)33/h7-8,12-13,15,18H,2-6,9-11H2,1H3,(H,27,30)(H,28,32,33)/t12-,15?,18+/m1/s1 |
| InChIKey | IATDMMGSZYXDGP-YOAWFHMFSA-N |
| XLogP | 3.60 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|