C12H18N2 — CID 171543529
(3E,5Z)-N-(methylideneamino)-N-(2-methylprop-1-enyl)hepta-1,3,5-trien-3-amine (PubChem CID 171543529) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (3E,5Z)-N-(methylideneamino)-N-(2-methylprop-1-enyl)hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5Z)-N-(methylideneamino)-N-(2-methylprop-1-enyl)hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 171543529 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (3E,5Z)-N-(methylideneamino)-N-(2-methylprop-1-enyl)hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C=C/C)N(C=C(C)C)N=C |
| InChI | InChI=1S/C12H18N2/c1-6-8-9-12(7-2)14(13-5)10-11(3)4/h6-10H,2,5H2,1,3-4H3/b8-6-,12-9+ |
| InChIKey | OIPXTYZPIMCCIT-ZHAQITPWSA-N |
| XLogP | 3.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|