C17H25BO3 — CID 171555444
1-[(1E,5Z,7Z)-7-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cycloocta-1,5,7-trien-1-yl]ethanone (PubChem CID 171555444) has the molecular formula C17H25BO3 and a molecular weight of 288.20 g/mol. Its IUPAC name is 1-[(1E,5Z,7Z)-7-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cycloocta-1,5,7-trien-1-yl]ethanone.
| Compound Name | 1-[(1E,5Z,7Z)-7-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cycloocta-1,5,7-trien-1-yl]ethanone |
|---|---|
| PubChem CID | 171555444 |
| Molecular Formula | C17H25BO3 |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 1-[(1E,5Z,7Z)-7-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cycloocta-1,5,7-trien-1-yl]ethanone |
| SMILES | CC(=O)C1=C/CC/C=C(B2OC(C)(C)C(C)(C)O2)/C(C)=C\1 |
| InChI | InChI=1S/C17H25BO3/c1-12-11-14(13(2)19)9-7-8-10-15(12)18-20-16(3,4)17(5,6)21-18/h9-11H,7-8H2,1-6H3/b12-11-,14-9+,15-10+ |
| InChIKey | CVEIAPUDZMCBNF-SSFISQQDSA-N |
| XLogP | 3.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|