C19H27F3N6O4 — CID 171558076
(Z,2E)-4-amino-2-(aminomethylidene)-N-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methyl]but-3-enamide;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171558076) has the molecular formula C19H27F3N6O4 and a molecular weight of 460.46 g/mol. Its IUPAC name is (Z,2E)-4-amino-2-(aminomethylidene)-N-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methyl]but-3-enamide;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | (Z,2E)-4-amino-2-(aminomethylidene)-N-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methyl]but-3-enamide;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171558076 |
| Molecular Formula | C19H27F3N6O4 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | (Z,2E)-4-amino-2-(aminomethylidene)-N-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methyl]but-3-enamide;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC1(C)OC2CCOC(CNC(=O)C(/C=C\N)=C/N)C2O1.Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H23N3O4.C5H4F3N3/c1-14(2)20-10-4-6-19-11(12(10)21-14)8-17-13(18)9(7-16)3-5-15;6-5(7,8)3-1-10-2-4(9)11-3/h3,5,7,10-12H,4,6,8,15-16H2,1-2H3,(H,17,18);1-2H,(H2,9,11)/b5-3-,9-7+; |
| InChIKey | NKDGAPDEWCKHKX-ANNMPNGDSA-N |
| XLogP | 0.80 |
| TPSA | 160.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|