C29H19F2O2S+ — CID 171589622
(4,6-difluoro-1-methylinden-1-yl) 5-phenyldibenzothiophen-5-ium-2-carboxylate (PubChem CID 171589622) has the molecular formula C29H19F2O2S+ and a molecular weight of 469.53 g/mol. Its IUPAC name is (4,6-difluoro-1-methylinden-1-yl) 5-phenyldibenzothiophen-5-ium-2-carboxylate.
| Compound Name | (4,6-difluoro-1-methylinden-1-yl) 5-phenyldibenzothiophen-5-ium-2-carboxylate |
|---|---|
| PubChem CID | 171589622 |
| Molecular Formula | C29H19F2O2S+ |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | (4,6-difluoro-1-methylinden-1-yl) 5-phenyldibenzothiophen-5-ium-2-carboxylate |
| SMILES | CC1(OC(=O)c2ccc3c(c2)c2ccccc2[s+]3-c2ccccc2)C=Cc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C29H19F2O2S/c1-29(14-13-22-24(29)16-19(30)17-25(22)31)33-28(32)18-11-12-27-23(15-18)21-9-5-6-10-26(21)34(27)20-7-3-2-4-8-20/h2-17H,1H3/q+1 |
| InChIKey | BDQHJTVEALGBSA-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|