C20H17NY-2 — CID 171607350
N,N-dimethyl-2-phenyl-6-phenylbenzene-5-id-1-amine;yttrium (PubChem CID 171607350) has the molecular formula C20H17NY-2 and a molecular weight of 360.27 g/mol. Its IUPAC name is N,N-dimethyl-2-phenyl-6-phenylbenzene-5-id-1-amine;yttrium.
| Compound Name | N,N-dimethyl-2-phenyl-6-phenylbenzene-5-id-1-amine;yttrium |
|---|---|
| PubChem CID | 171607350 |
| Molecular Formula | C20H17NY-2 |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | N,N-dimethyl-2-phenyl-6-phenylbenzene-5-id-1-amine;yttrium |
| SMILES | CN(C)c1c(-c2[c-]cccc2)[c-]ccc1-c1ccccc1.[Y] |
| InChI | InChI=1S/C20H17N.Y/c1-21(2)20-18(16-10-5-3-6-11-16)14-9-15-19(20)17-12-7-4-8-13-17;/h3-12,14H,1-2H3;/q-2; |
| InChIKey | XSJZNPYFFKPCEI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|