C21H33FN3O9P — CID 171628809
[[5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-(prop-1-en-2-yloxymethoxy)phosphanyl]oxymethyl propan-2-yl carbonate;propane (PubChem CID 171628809) has the molecular formula C21H33FN3O9P and a molecular weight of 521.48 g/mol. Its IUPAC name is [[5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-(prop-1-en-2-yloxymethoxy)phosphanyl]oxymethyl propan-2-yl carbonate;propane.
| Compound Name | [[5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-(prop-1-en-2-yloxymethoxy)phosphanyl]oxymethyl propan-2-yl carbonate;propane |
|---|---|
| PubChem CID | 171628809 |
| Molecular Formula | C21H33FN3O9P |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | [[5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methoxy-(prop-1-en-2-yloxymethoxy)phosphanyl]oxymethyl propan-2-yl carbonate;propane |
| SMILES | C=C(C)OCOP(OCOC(=O)OC(C)C)OCC1C=CC(n2cc(F)c(N)nc2=O)O1.CCC |
| InChI | InChI=1S/C18H25FN3O9P.C3H8/c1-11(2)25-9-28-32(29-10-26-18(24)30-12(3)4)27-8-13-5-6-15(31-13)22-7-14(19)16(20)21-17(22)23;1-3-2/h5-7,12-13,15H,1,8-10H2,2-4H3,(H2,20,21,23);3H2,1-2H3 |
| InChIKey | HPUURDZFCCFYNT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 142.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|