C19H30N5O2P — CID 171722018
tert-butyl N-[4-[(5-amino-1-phosphanylpyrrolo[2,3-b]pyridin-4-yl)amino]-1-methylcyclohexyl]carbamate (PubChem CID 171722018) has the molecular formula C19H30N5O2P and a molecular weight of 391.46 g/mol. Its IUPAC name is tert-butyl N-[4-[(5-amino-1-phosphanylpyrrolo[2,3-b]pyridin-4-yl)amino]-1-methylcyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(5-amino-1-phosphanylpyrrolo[2,3-b]pyridin-4-yl)amino]-1-methylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 171722018 |
| Molecular Formula | C19H30N5O2P |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | tert-butyl N-[4-[(5-amino-1-phosphanylpyrrolo[2,3-b]pyridin-4-yl)amino]-1-methylcyclohexyl]carbamate |
| SMILES | CC1(NC(=O)OC(C)(C)C)CCC(Nc2c(N)cnc3c2ccn3P)CC1 |
| InChI | InChI=1S/C19H30N5O2P/c1-18(2,3)26-17(25)23-19(4)8-5-12(6-9-19)22-15-13-7-10-24(27)16(13)21-11-14(15)20/h7,10-12H,5-6,8-9,20,27H2,1-4H3,(H,21,22)(H,23,25) |
| InChIKey | RTMQHZAYAZDNFE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|