C34H24O4 — CID 171734376
2-[4-[4-(5,6-dimethyl-1,3-dioxoinden-2-ylidene)cyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-5,6-dimethylindene-1,3-dione (PubChem CID 171734376) has the molecular formula C34H24O4 and a molecular weight of 496.56 g/mol. Its IUPAC name is 2-[4-[4-(5,6-dimethyl-1,3-dioxoinden-2-ylidene)cyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-5,6-dimethylindene-1,3-dione.
| Compound Name | 2-[4-[4-(5,6-dimethyl-1,3-dioxoinden-2-ylidene)cyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-5,6-dimethylindene-1,3-dione |
|---|---|
| PubChem CID | 171734376 |
| Molecular Formula | C34H24O4 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 2-[4-[4-(5,6-dimethyl-1,3-dioxoinden-2-ylidene)cyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-5,6-dimethylindene-1,3-dione |
| SMILES | Cc1cc2c(cc1C)C(=O)C(=c1ccc(=c3ccc(=C4C(=O)c5cc(C)c(C)cc5C4=O)cc3)cc1)C2=O |
| InChI | InChI=1S/C34H24O4/c1-17-13-25-26(14-18(17)2)32(36)29(31(25)35)23-9-5-21(6-10-23)22-7-11-24(12-8-22)30-33(37)27-15-19(3)20(4)16-28(27)34(30)38/h5-16H,1-4H3 |
| InChIKey | FZGAWFZHPJNTRF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'} |
|---|