C23H24Cl2N4 — CID 171793158
9-N-(2-aminoethyl)-7-chloro-2-N-(4-chlorophenyl)acridine-2,9-diamine;ethane (PubChem CID 171793158) has the molecular formula C23H24Cl2N4 and a molecular weight of 427.38 g/mol. Its IUPAC name is 9-N-(2-aminoethyl)-7-chloro-2-N-(4-chlorophenyl)acridine-2,9-diamine;ethane.
| Compound Name | 9-N-(2-aminoethyl)-7-chloro-2-N-(4-chlorophenyl)acridine-2,9-diamine;ethane |
|---|---|
| PubChem CID | 171793158 |
| Molecular Formula | C23H24Cl2N4 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 9-N-(2-aminoethyl)-7-chloro-2-N-(4-chlorophenyl)acridine-2,9-diamine;ethane |
| SMILES | CC.NCCNc1c2cc(Cl)ccc2nc2ccc(Nc3ccc(Cl)cc3)cc12 |
| InChI | InChI=1S/C21H18Cl2N4.C2H6/c22-13-1-4-15(5-2-13)26-16-6-8-20-18(12-16)21(25-10-9-24)17-11-14(23)3-7-19(17)27-20;1-2/h1-8,11-12,26H,9-10,24H2,(H,25,27);1-2H3 |
| InChIKey | MXCFGKFIWPRSOR-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|