C29H35ClIN4O2- — CID 171794009
tert-butyl N-[2-[3-(aminomethylideneamino)-6-chloro-9-methyliodanuidylcarbazol-1-yl]ethyl]carbamate;1,4-xylene (PubChem CID 171794009) has the molecular formula C29H35ClIN4O2- and a molecular weight of 633.98 g/mol. Its IUPAC name is tert-butyl N-[2-[3-(aminomethylideneamino)-6-chloro-9-methyliodanuidylcarbazol-1-yl]ethyl]carbamate;1,4-xylene.
| Compound Name | tert-butyl N-[2-[3-(aminomethylideneamino)-6-chloro-9-methyliodanuidylcarbazol-1-yl]ethyl]carbamate;1,4-xylene |
|---|---|
| PubChem CID | 171794009 |
| Molecular Formula | C29H35ClIN4O2- |
| Molecular Weight | 633.98 g/mol |
| Exact Mass | 633.15 |
| IUPAC Name | tert-butyl N-[2-[3-(aminomethylideneamino)-6-chloro-9-methyliodanuidylcarbazol-1-yl]ethyl]carbamate;1,4-xylene |
| SMILES | C[I-]n1c2ccc(Cl)cc2c2cc(/N=C/N)cc(CCNC(=O)OC(C)(C)C)c21.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C21H25ClIN4O2.C8H10/c1-21(2,3)29-20(28)25-8-7-13-9-15(26-12-24)11-17-16-10-14(22)5-6-18(16)27(23-4)19(13)17;1-7-3-5-8(2)6-4-7/h5-6,9-12H,7-8H2,1-4H3,(H2,24,26)(H,25,28);3-6H,1-2H3/q-1; |
| InChIKey | PSCGFFXKSYURIS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 81.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.98 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|