C19H23FN4O4 — CID 171821149
tert-butyl 4-[4-(5-fluoro-2,4-dioxopyrimidin-1-yl)phenyl]piperazine-1-carboxylate (PubChem CID 171821149) has the molecular formula C19H23FN4O4 and a molecular weight of 390.42 g/mol. Its IUPAC name is tert-butyl 4-[4-(5-fluoro-2,4-dioxopyrimidin-1-yl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(5-fluoro-2,4-dioxopyrimidin-1-yl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171821149 |
| Molecular Formula | C19H23FN4O4 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | tert-butyl 4-[4-(5-fluoro-2,4-dioxopyrimidin-1-yl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(-n3cc(F)c(=O)[nH]c3=O)cc2)CC1 |
| InChI | InChI=1S/C19H23FN4O4/c1-19(2,3)28-18(27)23-10-8-22(9-11-23)13-4-6-14(7-5-13)24-12-15(20)16(25)21-17(24)26/h4-7,12H,8-11H2,1-3H3,(H,21,25,26) |
| InChIKey | RMNQJIPYEGTEHZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|