About 2-ethylhexyl formate;(2Z)-2-(3-phenylcyclopent-2-en-1-ylidene)propanenitrile
2-ethylhexyl formate;(2Z)-2-(3-phenylcyclopent-2-en-1-ylidene)propanenitrile (PubChem CID 171833772) has the molecular formula C23H31NO2
and a molecular weight of 353.51 g/mol. Its IUPAC name is 2-ethylhexyl formate;(2Z)-2-(3-phenylcyclopent-2-en-1-ylidene)propanenitrile.
Molecular Properties
| Compound Name | 2-ethylhexyl formate;(2Z)-2-(3-phenylcyclopent-2-en-1-ylidene)propanenitrile |
| PubChem CID | 171833772 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 2-ethylhexyl formate;(2Z)-2-(3-phenylcyclopent-2-en-1-ylidene)propanenitrile |
| SMILES | C/C(C#N)=C1/C=C(c2ccccc2)CC1.CCCCC(CC)COC=O |
| InChI | InChI=1S/C14H13N.C9H18O2/c1-11(10-15)13-7-8-14(9-13)12-5-3-2-4-6-12;1-3-5-6-9(4-2)7-11-8-10/h2-6,9H,7-8H2,1H3;8-9H,3-7H2,1-2H3/b13-11-; |
| InChIKey | YCWWRGNIAPRBEJ-KEHAOADBSA-N |
| XLogP | 6.08 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexyl formate;(2Z)-2-(3-phenylcyclopent-2-en-1-ylidene)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl formate;(2Z)-2-(3-phenylcyclopent-2-en-1-ylidene)propanenitrile?
The IUPAC name of 2-ethylhexyl formate;(2Z)-2-(3-phenylcyclopent-2-en-1-ylidene)propanenitrile (CID 171833772) is 2-ethylhexyl formate;(2Z)-2-(3-phenylcyclopent-2-en-1-ylidene)propanenitrile.
What is the SMILES notation for 2-ethylhexyl formate;(2Z)-2-(3-phenylcyclopent-2-en-1-ylidene)propanenitrile?
The canonical SMILES for 2-ethylhexyl formate;(2Z)-2-(3-phenylcyclopent-2-en-1-ylidene)propanenitrile is C/C(C#N)=C1/C=C(c2ccccc2)CC1.CCCCC(CC)COC=O.
What is the InChIKey of 2-ethylhexyl formate;(2Z)-2-(3-phenylcyclopent-2-en-1-ylidene)propanenitrile?
The InChIKey is YCWWRGNIAPRBEJ-KEHAOADBSA-N. The full InChI is InChI=1S/C14H13N.C9H18O2/c1-11(10-15)13-7-8-14(9-13)12-5-3-2-4-6-12;1-3-5-6-9(4-2)7-11-8-10/h2-6,9H,7-8H2,1H3;8-9H,3-7H2,1-2H3/b13-11-;.
What are the key properties of 2-ethylhexyl formate;(2Z)-2-(3-phenylcyclopent-2-en-1-ylidene)propanenitrile?
2-ethylhexyl formate;(2Z)-2-(3-phenylcyclopent-2-en-1-ylidene)propanenitrile has a molecular weight of 353.51 g/mol, XLogP of 6.08, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl formate;(2Z)-2-(3-phenylcyclopent-2-en-1-ylidene)propanenitrile is sourced from PubChem (CID 171833772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).