C13H15NO4 — CID 171901698
4-[3-(1,3-dioxolan-2-yl)phenyl]-3,4-dihydroxybutanenitrile (PubChem CID 171901698) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-[3-(1,3-dioxolan-2-yl)phenyl]-3,4-dihydroxybutanenitrile.
| Compound Name | 4-[3-(1,3-dioxolan-2-yl)phenyl]-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171901698 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 4-[3-(1,3-dioxolan-2-yl)phenyl]-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1cccc(C2OCCO2)c1 |
| InChI | InChI=1S/C13H15NO4/c14-5-4-11(15)12(16)9-2-1-3-10(8-9)13-17-6-7-18-13/h1-3,8,11-13,15-16H,4,6-7H2 |
| InChIKey | PNDBBVTYKZSTAT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |