C26H37N11O2 — CID 172523130
5-amino-1-[4-[4-[[5-azido-7-(butylamino)pyrazolo[4,3-d]pyrimidin-2-yl]methyl]-3-methoxyphenyl]piperazin-1-yl]pentan-1-one (PubChem CID 172523130) has the molecular formula C26H37N11O2 and a molecular weight of 535.66 g/mol. Its IUPAC name is 5-amino-1-[4-[4-[[5-azido-7-(butylamino)pyrazolo[4,3-d]pyrimidin-2-yl]methyl]-3-methoxyphenyl]piperazin-1-yl]pentan-1-one.
| Compound Name | 5-amino-1-[4-[4-[[5-azido-7-(butylamino)pyrazolo[4,3-d]pyrimidin-2-yl]methyl]-3-methoxyphenyl]piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 172523130 |
| Molecular Formula | C26H37N11O2 |
| Molecular Weight | 535.66 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | 5-amino-1-[4-[4-[[5-azido-7-(butylamino)pyrazolo[4,3-d]pyrimidin-2-yl]methyl]-3-methoxyphenyl]piperazin-1-yl]pentan-1-one |
| SMILES | CCCCNc1nc(N=[N+]=[N-])nc2cn(Cc3ccc(N4CCN(C(=O)CCCCN)CC4)cc3OC)nc12 |
| InChI | InChI=1S/C26H37N11O2/c1-3-4-11-29-25-24-21(30-26(31-25)32-34-28)18-37(33-24)17-19-8-9-20(16-22(19)39-2)35-12-14-36(15-13-35)23(38)7-5-6-10-27/h8-9,16,18H,3-7,10-15,17,27H2,1-2H3,(H,29,30,31) |
| InChIKey | VWWZEWZULMFUEW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 163.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.66 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|