About CID 172534835
CID 172534835 (PubChem CID 172534835) has the molecular formula C47H42FIrN3O-2
and a molecular weight of 876.09 g/mol.
Molecular Properties
| Compound Name | CID 172534835 |
| PubChem CID | 172534835 |
| Molecular Formula | C47H42FIrN3O-2 |
| Molecular Weight | 876.09 g/mol |
| Exact Mass | 876.30 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]cc(F)cc2)c1.CC1(C)CCC(C)(C)c2nc(-c3[c-]ccc4c3oc3cc5c(ccc6ccccc65)cc34)ncc21.[Ir] |
| InChI | InChI=1S/C32H27N2O.C15H15FN.Ir/c1-31(2)14-15-32(3,4)29-26(31)18-33-30(34-29)23-11-7-10-22-25-16-20-13-12-19-8-5-6-9-21(19)24(20)17-27(25)35-28(22)23;1-15(2,3)12-8-9-17-14(10-12)11-4-6-13(16)7-5-11;/h5-10,12-13,16-18H,14-15H2,1-4H3;4,6-10H,1-3H3;/q2*-1; |
| InChIKey | JFULSOHQCQOZRR-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 876.09 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 172534835 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172534835?
The IUPAC name of CID 172534835 (CID 172534835) is not available.
What is the SMILES notation for CID 172534835?
The canonical SMILES for CID 172534835 is CC(C)(C)c1ccnc(-c2[c-]cc(F)cc2)c1.CC1(C)CCC(C)(C)c2nc(-c3[c-]ccc4c3oc3cc5c(ccc6ccccc65)cc34)ncc21.[Ir].
What is the InChIKey of CID 172534835?
The InChIKey is JFULSOHQCQOZRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H27N2O.C15H15FN.Ir/c1-31(2)14-15-32(3,4)29-26(31)18-33-30(34-29)23-11-7-10-22-25-16-20-13-12-19-8-5-6-9-21(19)24(20)17-27(25)35-28(22)23;1-15(2,3)12-8-9-17-14(10-12)11-4-6-13(16)7-5-11;/h5-10,12-13,16-18H,14-15H2,1-4H3;4,6-10H,1-3H3;/q2*-1;.
What are the key properties of CID 172534835?
CID 172534835 has a molecular weight of 876.09 g/mol, XLogP of 12.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172534835 is sourced from PubChem (CID 172534835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).