C25H33N2Si2+ — CID 172534879
3,5,5,8,8-pentamethyl-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]-6,7-dihydro-[1,4]disilino[2,3-d]pyrimidin-3-ium (PubChem CID 172534879) has the molecular formula C25H33N2Si2+ and a molecular weight of 420.74 g/mol. Its IUPAC name is 3,5,5,8,8-pentamethyl-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]-6,7-dihydro-[1,4]disilino[2,3-d]pyrimidin-3-ium.
| Compound Name | 3,5,5,8,8-pentamethyl-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]-6,7-dihydro-[1,4]disilino[2,3-d]pyrimidin-3-ium |
|---|---|
| PubChem CID | 172534879 |
| Molecular Formula | C25H33N2Si2+ |
| Molecular Weight | 420.74 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 3,5,5,8,8-pentamethyl-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]-6,7-dihydro-[1,4]disilino[2,3-d]pyrimidin-3-ium |
| SMILES | [2H]C([2H])([2H])c1cc(C)c(-c2nc3c(c[n+]2C)[Si](C)(C)CC[Si]3(C)C)cc1-c1ccccc1 |
| InChI | InChI=1S/C25H33N2Si2/c1-18-15-19(2)22(16-21(18)20-11-9-8-10-12-20)24-26-25-23(17-27(24)3)28(4,5)13-14-29(25,6)7/h8-12,15-17H,13-14H2,1-7H3/q+1/i1D3 |
| InChIKey | PBJOUTXDWYNCGL-FIBGUPNXSA-N |
| XLogP | 4.70 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.74 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|