C28H24F16N2O2 — CID 172550494
4-[8-(4-amino-3-cyclopropyl-5-methoxyphenyl)-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctyl]-2-cyclopropyl-6-methoxyaniline (PubChem CID 172550494) has the molecular formula C28H24F16N2O2 and a molecular weight of 724.48 g/mol. Its IUPAC name is 4-[8-(4-amino-3-cyclopropyl-5-methoxyphenyl)-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctyl]-2-cyclopropyl-6-methoxyaniline.
| Compound Name | 4-[8-(4-amino-3-cyclopropyl-5-methoxyphenyl)-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctyl]-2-cyclopropyl-6-methoxyaniline |
|---|---|
| PubChem CID | 172550494 |
| Molecular Formula | C28H24F16N2O2 |
| Molecular Weight | 724.48 g/mol |
| Exact Mass | 724.16 |
| IUPAC Name | 4-[8-(4-amino-3-cyclopropyl-5-methoxyphenyl)-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctyl]-2-cyclopropyl-6-methoxyaniline |
| SMILES | COc1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c2cc(OC)c(N)c(C3CC3)c2)cc(C2CC2)c1N |
| InChI | InChI=1S/C28H24F16N2O2/c1-47-17-9-13(7-15(19(17)45)11-3-4-11)21(29,30)23(33,34)25(37,38)27(41,42)28(43,44)26(39,40)24(35,36)22(31,32)14-8-16(12-5-6-12)20(46)18(10-14)48-2/h7-12H,3-6,45-46H2,1-2H3 |
| InChIKey | OUFVAGHNTDBAFX-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.48 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|