C21H17NO6S2 — CID 172563377
(1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) phenyl sulfate (PubChem CID 172563377) has the molecular formula C21H17NO6S2 and a molecular weight of 443.50 g/mol. Its IUPAC name is (1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) phenyl sulfate.
| Compound Name | (1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) phenyl sulfate |
|---|---|
| PubChem CID | 172563377 |
| Molecular Formula | C21H17NO6S2 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | (1,3-dioxo-6-propan-2-ylsulfanylbenzo[de]isoquinolin-2-yl) phenyl sulfate |
| SMILES | CC(C)Sc1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)Oc1ccccc1)C2=O |
| InChI | InChI=1S/C21H17NO6S2/c1-13(2)29-18-12-11-17-19-15(18)9-6-10-16(19)20(23)22(21(17)24)28-30(25,26)27-14-7-4-3-5-8-14/h3-13H,1-2H3 |
| InChIKey | DIDBLTCPHWFWQK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|