C37H56BN5O5Si — CID 172623862
tert-butyl N-[(3R)-1-[[2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-4-pyridinyl]methyl]piperidin-3-yl]carbamate (PubChem CID 172623862) has the molecular formula C37H56BN5O5Si and a molecular weight of 689.78 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[[2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-4-pyridinyl]methyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[[2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-4-pyridinyl]methyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 172623862 |
| Molecular Formula | C37H56BN5O5Si |
| Molecular Weight | 689.78 g/mol |
| Exact Mass | 689.41 |
| IUPAC Name | tert-butyl N-[(3R)-1-[[2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-4-pyridinyl]methyl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCN(Cc2ccnc(-c3ncc(-c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)n3COCC[Si](C)(C)C)c2)C1 |
| InChI | InChI=1S/C37H56BN5O5Si/c1-35(2,3)46-34(44)41-30-12-11-19-42(25-30)24-27-17-18-39-31(22-27)33-40-23-32(43(33)26-45-20-21-49(8,9)10)28-13-15-29(16-14-28)38-47-36(4,5)37(6,7)48-38/h13-18,22-23,30H,11-12,19-21,24-26H2,1-10H3,(H,41,44)/t30-/m1/s1 |
| InChIKey | GNEBDGAMVCWJJD-SSEXGKCCSA-N |
| XLogP | 6.71 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.78 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|