C21H27N2O4+ — CID 172645891
2-(4-aminobenzoyl)oxyethyl-(1,3-benzodioxol-5-ylmethyl)-diethylazanium (PubChem CID 172645891) has the molecular formula C21H27N2O4+ and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-(4-aminobenzoyl)oxyethyl-(1,3-benzodioxol-5-ylmethyl)-diethylazanium.
| Compound Name | 2-(4-aminobenzoyl)oxyethyl-(1,3-benzodioxol-5-ylmethyl)-diethylazanium |
|---|---|
| PubChem CID | 172645891 |
| Molecular Formula | C21H27N2O4+ |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 2-(4-aminobenzoyl)oxyethyl-(1,3-benzodioxol-5-ylmethyl)-diethylazanium |
| SMILES | CC[N+](CC)(CCOC(=O)c1ccc(N)cc1)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H26N2O4/c1-3-23(4-2,14-16-5-10-19-20(13-16)27-15-26-19)11-12-25-21(24)17-6-8-18(22)9-7-17/h5-10,13H,3-4,11-12,14-15H2,1-2H3,(H-,22,24)/p+1 |
| InChIKey | WKYGUVMDHRHPHL-UHFFFAOYSA-O |
| XLogP | 3.21 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|