C39H42NO5S3+ — CID 172696489
N-(benzenesulfonyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide;10-phenylphenoxathiin-10-ium (PubChem CID 172696489) has the molecular formula C39H42NO5S3+ and a molecular weight of 700.97 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide;10-phenylphenoxathiin-10-ium.
| Compound Name | N-(benzenesulfonyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide;10-phenylphenoxathiin-10-ium |
|---|---|
| PubChem CID | 172696489 |
| Molecular Formula | C39H42NO5S3+ |
| Molecular Weight | 700.97 g/mol |
| Exact Mass | 700.22 |
| IUPAC Name | N-(benzenesulfonyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide;10-phenylphenoxathiin-10-ium |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)NS(=O)(=O)c2ccccc2)c(C(C)C)c1.c1ccc([S+]2c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C21H29NO4S2.C18H13OS/c1-14(2)17-12-19(15(3)4)21(20(13-17)16(5)6)28(25,26)22-27(23,24)18-10-8-7-9-11-18;1-2-8-14(9-3-1)20-17-12-6-4-10-15(17)19-16-11-5-7-13-18(16)20/h7-16,22H,1-6H3;1-13H/q;+1 |
| InChIKey | CJTYYSSEMMRASB-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.97 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|