C20H33ClN4O9S — CID 172704252
N-[2-[2-[2-[2-[[(1S,2R,3R,4R,5S)-4-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 172704252) has the molecular formula C20H33ClN4O9S and a molecular weight of 541.02 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[[(1S,2R,3R,4R,5S)-4-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | N-[2-[2-[2-[2-[[(1S,2R,3R,4R,5S)-4-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 172704252 |
| Molecular Formula | C20H33ClN4O9S |
| Molecular Weight | 541.02 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | N-[2-[2-[2-[2-[[(1S,2R,3R,4R,5S)-4-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CCC(=O)NCCOCCOCCOCCOC[C@@]12CO[C@@H](O1)[C@H](Nc1nc(Cl)ns1)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C20H33ClN4O9S/c1-2-13(26)22-3-4-29-5-6-30-7-8-31-9-10-32-11-20-12-33-17(34-20)14(15(27)16(20)28)23-19-24-18(21)25-35-19/h14-17,27-28H,2-12H2,1H3,(H,22,26)(H,23,24,25)/t14-,15-,16-,17+,20+/m1/s1 |
| InChIKey | DJGKPCQDLBNVAC-PANQXIRQSA-N |
| XLogP | -0.59 |
| TPSA | 162.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.02 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|