C13H16F6N6 — CID 172706843
6-(3-aminobut-1-ynyl)-2-N,4-N-bis[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 172706843) has the molecular formula C13H16F6N6 and a molecular weight of 370.30 g/mol. Its IUPAC name is 6-(3-aminobut-1-ynyl)-2-N,4-N-bis[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3-aminobut-1-ynyl)-2-N,4-N-bis[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 172706843 |
| Molecular Formula | C13H16F6N6 |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 6-(3-aminobut-1-ynyl)-2-N,4-N-bis[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | CC(N)C#Cc1nc(N[C@H](C)C(F)(F)F)nc(N[C@H](C)C(F)(F)F)n1 |
| InChI | InChI=1S/C13H16F6N6/c1-6(20)4-5-9-23-10(21-7(2)12(14,15)16)25-11(24-9)22-8(3)13(17,18)19/h6-8H,20H2,1-3H3,(H2,21,22,23,24,25)/t6?,7-,8-/m1/s1 |
| InChIKey | DRVWDTRMNNKFJY-SPDVFEMOSA-N |
| XLogP | 2.30 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|