C18H21F6N5 — CID 167061043
6-[2-(1-cyclobutylcyclopropyl)ethynyl]-2-N,4-N-bis[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 167061043) has the molecular formula C18H21F6N5 and a molecular weight of 421.39 g/mol. Its IUPAC name is 6-[2-(1-cyclobutylcyclopropyl)ethynyl]-2-N,4-N-bis[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[2-(1-cyclobutylcyclopropyl)ethynyl]-2-N,4-N-bis[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 167061043 |
| Molecular Formula | C18H21F6N5 |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 6-[2-(1-cyclobutylcyclopropyl)ethynyl]-2-N,4-N-bis[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@@H](Nc1nc(C#CC2(C3CCC3)CC2)nc(N[C@H](C)C(F)(F)F)n1)C(F)(F)F |
| InChI | InChI=1S/C18H21F6N5/c1-10(17(19,20)21)25-14-27-13(6-7-16(8-9-16)12-4-3-5-12)28-15(29-14)26-11(2)18(22,23)24/h10-12H,3-5,8-9H2,1-2H3,(H2,25,26,27,28,29)/t10-,11-/m1/s1 |
| InChIKey | SRKONHIGTIGIQK-GHMZBOCLSA-N |
| XLogP | 4.53 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|