C20H31NO4 — CID 172709990
7-[2-(6-cyano-3-hydroxyhept-1-enyl)-5-oxocyclopentyl]heptanoic acid (PubChem CID 172709990) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is 7-[2-(6-cyano-3-hydroxyhept-1-enyl)-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[2-(6-cyano-3-hydroxyhept-1-enyl)-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 172709990 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 7-[2-(6-cyano-3-hydroxyhept-1-enyl)-5-oxocyclopentyl]heptanoic acid |
| SMILES | CC(C#N)CCC(O)C=CC1CCC(=O)C1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H31NO4/c1-15(14-21)8-11-17(22)12-9-16-10-13-19(23)18(16)6-4-2-3-5-7-20(24)25/h9,12,15-18,22H,2-8,10-11,13H2,1H3,(H,24,25) |
| InChIKey | FCSDABNGBHCFJD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|