About chloric acid;hydrate
chloric acid;hydrate (PubChem CID 172725016) has the molecular formula H4Cl2O7
and a molecular weight of 186.93 g/mol. Its IUPAC name is chloric acid;hydrate.
Molecular Properties
| Compound Name | chloric acid;hydrate |
| PubChem CID | 172725016 |
| Molecular Formula | H4Cl2O7 |
| Molecular Weight | 186.93 g/mol |
| Exact Mass | 185.93 |
| IUPAC Name | chloric acid;hydrate |
| SMILES | O.[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O |
| InChI | InChI=1S/2ClHO3.H2O/c2*2-1(3)4;/h2*2H;1H2 |
| InChIKey | DWYJVUQEAPXRQX-UHFFFAOYSA-N |
| XLogP | -6.69 |
| TPSA | 164.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.93 |
| LogP ≤ 5 | -6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze chloric acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloric acid;hydrate?
The IUPAC name of chloric acid;hydrate (CID 172725016) is chloric acid;hydrate.
What is the SMILES notation for chloric acid;hydrate?
The canonical SMILES for chloric acid;hydrate is O.[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.
What is the InChIKey of chloric acid;hydrate?
The InChIKey is DWYJVUQEAPXRQX-UHFFFAOYSA-N. The full InChI is InChI=1S/2ClHO3.H2O/c2*2-1(3)4;/h2*2H;1H2.
What are the key properties of chloric acid;hydrate?
chloric acid;hydrate has a molecular weight of 186.93 g/mol, XLogP of -6.69, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for chloric acid;hydrate is sourced from PubChem (CID 172725016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).