C32H33F3O4S2 — CID 172742975
1-(6-butoxynaphthalen-2-yl)thiolan-1-ium;9H-fluorene;trifluoromethanesulfonate (PubChem CID 172742975) has the molecular formula C32H33F3O4S2 and a molecular weight of 602.74 g/mol. Its IUPAC name is 1-(6-butoxynaphthalen-2-yl)thiolan-1-ium;9H-fluorene;trifluoromethanesulfonate.
| Compound Name | 1-(6-butoxynaphthalen-2-yl)thiolan-1-ium;9H-fluorene;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 172742975 |
| Molecular Formula | C32H33F3O4S2 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | 1-(6-butoxynaphthalen-2-yl)thiolan-1-ium;9H-fluorene;trifluoromethanesulfonate |
| SMILES | CCCCOc1ccc2cc([S+]3CCCC3)ccc2c1.O=S(=O)([O-])C(F)(F)F.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C18H23OS.C13H10.CHF3O3S/c1-2-3-10-19-17-8-6-16-14-18(9-7-15(16)13-17)20-11-4-5-12-20;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;2-1(3,4)8(5,6)7/h6-9,13-14H,2-5,10-12H2,1H3;1-8H,9H2;(H,5,6,7)/q+1;;/p-1 |
| InChIKey | JINGWOODUFAUOH-UHFFFAOYSA-M |
| XLogP | 8.10 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|