4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid

C13H11NO5 — CID 172794025

IUPAC4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid
SMILESCC(=O)c1ccc(C(=O)O)c(N2C(=O)CCC2=O)c1
InChIInChI=1S/C13H11NO5/c1-7(15)8-2-3-9(13(18)19)10(6-8)14-11(16)4-5-12(14)17/h2-3,6H,4-5H2,1H3,(H,18,19)
InChIKeyPYMADVBVUBVCDO-UHFFFAOYSA-N
MW261.23 g/mol
LogP1.24
Rot. Bonds3

About 4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid

4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid (PubChem CID 172794025) has the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. Its IUPAC name is 4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid.

Molecular Properties

Compound Name4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid
PubChem CID172794025
Molecular FormulaC13H11NO5
Molecular Weight261.23 g/mol
Exact Mass261.06
IUPAC Name4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid
SMILESCC(=O)c1ccc(C(=O)O)c(N2C(=O)CCC2=O)c1
InChIInChI=1S/C13H11NO5/c1-7(15)8-2-3-9(13(18)19)10(6-8)14-11(16)4-5-12(14)17/h2-3,6H,4-5H2,1H3,(H,18,19)
InChIKeyPYMADVBVUBVCDO-UHFFFAOYSA-N
XLogP1.24
TPSA91.75 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.23
LogP ≤ 51.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid?
The IUPAC name of 4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid (CID 172794025) is 4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid.
What is the SMILES notation for 4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid?
The canonical SMILES for 4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid is CC(=O)c1ccc(C(=O)O)c(N2C(=O)CCC2=O)c1.
What is the InChIKey of 4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid?
The InChIKey is PYMADVBVUBVCDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO5/c1-7(15)8-2-3-9(13(18)19)10(6-8)14-11(16)4-5-12(14)17/h2-3,6H,4-5H2,1H3,(H,18,19).
What are the key properties of 4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid?
4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid has a molecular weight of 261.23 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-2-(2,5-dioxopyrrolidin-1-yl)benzoic acid is sourced from PubChem (CID 172794025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).