About 7H-purin-3-ium-6-amine bromide
7H-purin-3-ium-6-amine bromide (PubChem CID 172829786) has the molecular formula C5H6BrN5
and a molecular weight of 216.04 g/mol. Its IUPAC name is 7H-purin-3-ium-6-amine bromide.
Molecular Properties
| Compound Name | 7H-purin-3-ium-6-amine bromide |
| PubChem CID | 172829786 |
| Molecular Formula | C5H6BrN5 |
| Molecular Weight | 216.04 g/mol |
| Exact Mass | 214.98 |
| IUPAC Name | 7H-purin-3-ium-6-amine bromide |
| SMILES | Nc1nc[nH+]c2nc[nH]c12.[Br-] |
| InChI | InChI=1S/C5H5N5.BrH/c6-4-3-5(9-1-7-3)10-2-8-4;/h1-2H,(H3,6,7,8,9,10);1H |
| InChIKey | VIYODBXHEBSIMH-UHFFFAOYSA-N |
| XLogP | -3.64 |
| TPSA | 81.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.04 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7H-purin-3-ium-6-amine bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purin-3-ium-6-amine bromide?
The IUPAC name of 7H-purin-3-ium-6-amine bromide (CID 172829786) is 7H-purin-3-ium-6-amine bromide.
What is the SMILES notation for 7H-purin-3-ium-6-amine bromide?
The canonical SMILES for 7H-purin-3-ium-6-amine bromide is Nc1nc[nH+]c2nc[nH]c12.[Br-].
What is the InChIKey of 7H-purin-3-ium-6-amine bromide?
The InChIKey is VIYODBXHEBSIMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5.BrH/c6-4-3-5(9-1-7-3)10-2-8-4;/h1-2H,(H3,6,7,8,9,10);1H.
What are the key properties of 7H-purin-3-ium-6-amine bromide?
7H-purin-3-ium-6-amine bromide has a molecular weight of 216.04 g/mol, XLogP of -3.64, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purin-3-ium-6-amine bromide is sourced from PubChem (CID 172829786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).