C12H12N2O2 — CID 172850033
3'-methylspiro[1,2-dihydroindole-3,6'-oxazine]-4'-ol (PubChem CID 172850033) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 3'-methylspiro[1,2-dihydroindole-3,6'-oxazine]-4'-ol.
| Compound Name | 3'-methylspiro[1,2-dihydroindole-3,6'-oxazine]-4'-ol |
|---|---|
| PubChem CID | 172850033 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3'-methylspiro[1,2-dihydroindole-3,6'-oxazine]-4'-ol |
| SMILES | CC1=NOC2(C=C1O)CNc1ccccc12 |
| InChI | InChI=1S/C12H12N2O2/c1-8-11(15)6-12(16-14-8)7-13-10-5-3-2-4-9(10)12/h2-6,13,15H,7H2,1H3 |
| InChIKey | XYCKXVDZPAPLPR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |