C29H27N6O6S+ — CID 172850700
benzyl 1-(aminomethyl)-5-[(8R)-8-methyl-5-(3-methyl-4-nitrophenyl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-7-yl]-1,3,4-thiadiazol-1-ium-2-carboxylate (PubChem CID 172850700) has the molecular formula C29H27N6O6S+ and a molecular weight of 587.64 g/mol. Its IUPAC name is benzyl 1-(aminomethyl)-5-[(8R)-8-methyl-5-(3-methyl-4-nitrophenyl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-7-yl]-1,3,4-thiadiazol-1-ium-2-carboxylate.
| Compound Name | benzyl 1-(aminomethyl)-5-[(8R)-8-methyl-5-(3-methyl-4-nitrophenyl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-7-yl]-1,3,4-thiadiazol-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 172850700 |
| Molecular Formula | C29H27N6O6S+ |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | benzyl 1-(aminomethyl)-5-[(8R)-8-methyl-5-(3-methyl-4-nitrophenyl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-7-yl]-1,3,4-thiadiazol-1-ium-2-carboxylate |
| SMILES | Cc1cc(C2=NN(c3nnc(C(=O)OCc4ccccc4)[s+]3CN)[C@H](C)Cc3cc4c(cc32)OCO4)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H27N6O6S/c1-17-10-20(8-9-23(17)35(37)38)26-22-13-25-24(40-16-41-25)12-21(22)11-18(2)34(33-26)29-32-31-27(42(29)15-30)28(36)39-14-19-6-4-3-5-7-19/h3-10,12-13,18H,11,14-16,30H2,1-2H3/q+1/t18-,42?/m1/s1 |
| InChIKey | YAJQVQLATCFZDC-FZHZQARLSA-N |
| XLogP | 4.65 |
| TPSA | 155.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|