C23H21N5O6S — CID 69436160
ethyl 5-[(8R)-8-methyl-5-(3-methyl-4-nitrophenyl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-7-yl]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 69436160) has the molecular formula C23H21N5O6S and a molecular weight of 495.52 g/mol. Its IUPAC name is ethyl 5-[(8R)-8-methyl-5-(3-methyl-4-nitrophenyl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-7-yl]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | ethyl 5-[(8R)-8-methyl-5-(3-methyl-4-nitrophenyl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-7-yl]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 69436160 |
| Molecular Formula | C23H21N5O6S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | ethyl 5-[(8R)-8-methyl-5-(3-methyl-4-nitrophenyl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-7-yl]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nnc(N2N=C(c3ccc([N+](=O)[O-])c(C)c3)c3cc4c(cc3C[C@H]2C)OCO4)s1 |
| InChI | InChI=1S/C23H21N5O6S/c1-4-32-22(29)21-24-25-23(35-21)27-13(3)8-15-9-18-19(34-11-33-18)10-16(15)20(26-27)14-5-6-17(28(30)31)12(2)7-14/h5-7,9-10,13H,4,8,11H2,1-3H3/t13-/m1/s1 |
| InChIKey | HDDIMVDSLSBDFB-CYBMUJFWSA-N |
| XLogP | 3.86 |
| TPSA | 129.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|