C23H21N5O4S — CID 69434743
(8R)-8-methyl-5-(3-methyl-4-nitrophenyl)-7-(5-prop-1-enyl-1,3,4-thiadiazol-2-yl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine (PubChem CID 69434743) has the molecular formula C23H21N5O4S and a molecular weight of 463.52 g/mol. Its IUPAC name is (8R)-8-methyl-5-(3-methyl-4-nitrophenyl)-7-(5-prop-1-enyl-1,3,4-thiadiazol-2-yl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine.
| Compound Name | (8R)-8-methyl-5-(3-methyl-4-nitrophenyl)-7-(5-prop-1-enyl-1,3,4-thiadiazol-2-yl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine |
|---|---|
| PubChem CID | 69434743 |
| Molecular Formula | C23H21N5O4S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | (8R)-8-methyl-5-(3-methyl-4-nitrophenyl)-7-(5-prop-1-enyl-1,3,4-thiadiazol-2-yl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine |
| SMILES | CC=Cc1nnc(N2N=C(c3ccc([N+](=O)[O-])c(C)c3)c3cc4c(cc3C[C@H]2C)OCO4)s1 |
| InChI | InChI=1S/C23H21N5O4S/c1-4-5-21-24-25-23(33-21)27-14(3)9-16-10-19-20(32-12-31-19)11-17(16)22(26-27)15-6-7-18(28(29)30)13(2)8-15/h4-8,10-11,14H,9,12H2,1-3H3/t14-/m1/s1 |
| InChIKey | AIIMHSPFBGSYTF-CQSZACIVSA-N |
| XLogP | 4.72 |
| TPSA | 102.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|