C85H79N5 — CID 172861608
3,4-ditert-butyl-1-[1-(2,3-dibutylphenyl)-3,6-diphenyl-2,5-bis(2-phenylphenyl)-4H-triazin-4-yl]-2-phenylindolo[3,2-c]carbazole (PubChem CID 172861608) has the molecular formula C85H79N5 and a molecular weight of 1170.60 g/mol. Its IUPAC name is 3,4-ditert-butyl-1-[1-(2,3-dibutylphenyl)-3,6-diphenyl-2,5-bis(2-phenylphenyl)-4H-triazin-4-yl]-2-phenylindolo[3,2-c]carbazole.
| Compound Name | 3,4-ditert-butyl-1-[1-(2,3-dibutylphenyl)-3,6-diphenyl-2,5-bis(2-phenylphenyl)-4H-triazin-4-yl]-2-phenylindolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 172861608 |
| Molecular Formula | C85H79N5 |
| Molecular Weight | 1170.60 g/mol |
| Exact Mass | 1169.63 |
| IUPAC Name | 3,4-ditert-butyl-1-[1-(2,3-dibutylphenyl)-3,6-diphenyl-2,5-bis(2-phenylphenyl)-4H-triazin-4-yl]-2-phenylindolo[3,2-c]carbazole |
| SMILES | CCCCc1cccc(N2C(c3ccccc3)=C(c3ccccc3-c3ccccc3)C(c3c4c(c(C(C)(C)C)c(C(C)(C)C)c3-c3ccccc3)N=c3ccc5c(c3-4)N=c3ccccc3=5)N(c3ccccc3)N2c2ccccc2-c2ccccc2)c1CCCC |
| InChI | InChI=1S/C85H79N5/c1-9-11-35-58-44-34-54-71(64(58)47-12-10-2)89-82(61-42-24-16-25-43-61)74(67-51-29-28-48-63(67)57-36-18-13-19-37-57)83(88(62-45-26-17-27-46-62)90(89)72-53-33-31-49-65(72)59-38-20-14-21-39-59)77-73(60-40-22-15-23-41-60)78(84(3,4)5)79(85(6,7)8)81-76(77)75-70(87-81)56-55-68-66-50-30-32-52-69(66)86-80(68)75/h13-34,36-46,48-56,83H,9-12,35,47H2,1-8H3 |
| InChIKey | ZKSXXRWNBZXLBC-UHFFFAOYSA-N |
| XLogP | 21.42 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1170.60 |
| LogP ≤ 5 | 21.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|