C8H17F3NO2S+ — CID 172863826
dimethyl-propyl-(2,2,2-trifluoro-1-methylsulfonylethyl)azanium (PubChem CID 172863826) has the molecular formula C8H17F3NO2S+ and a molecular weight of 248.29 g/mol. Its IUPAC name is dimethyl-propyl-(2,2,2-trifluoro-1-methylsulfonylethyl)azanium.
| Compound Name | dimethyl-propyl-(2,2,2-trifluoro-1-methylsulfonylethyl)azanium |
|---|---|
| PubChem CID | 172863826 |
| Molecular Formula | C8H17F3NO2S+ |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | dimethyl-propyl-(2,2,2-trifluoro-1-methylsulfonylethyl)azanium |
| SMILES | CCC[N+](C)(C)C(C(F)(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C8H17F3NO2S/c1-5-6-12(2,3)7(8(9,10)11)15(4,13)14/h7H,5-6H2,1-4H3/q+1 |
| InChIKey | ZSFMKWCWROOWAW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|