C22H46N8O2Sn — CID 172917922
2-[(3E)-3-hydroxyiminopropyl]guanidine;2-[2-(5-tributylstannyl-1,2-oxazol-3-yl)ethyl]guanidine (PubChem CID 172917922) has the molecular formula C22H46N8O2Sn and a molecular weight of 573.38 g/mol. Its IUPAC name is 2-[(3E)-3-hydroxyiminopropyl]guanidine;2-[2-(5-tributylstannyl-1,2-oxazol-3-yl)ethyl]guanidine.
| Compound Name | 2-[(3E)-3-hydroxyiminopropyl]guanidine;2-[2-(5-tributylstannyl-1,2-oxazol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 172917922 |
| Molecular Formula | C22H46N8O2Sn |
| Molecular Weight | 573.38 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | 2-[(3E)-3-hydroxyiminopropyl]guanidine;2-[2-(5-tributylstannyl-1,2-oxazol-3-yl)ethyl]guanidine |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc(CCN=C(N)N)no1.NC(N)=NCC/C=N/O |
| InChI | InChI=1S/C6H9N4O.C4H10N4O.3C4H9.Sn/c7-6(8)9-3-1-5-2-4-11-10-5;5-4(6)7-2-1-3-8-9;3*1-3-4-2;/h2H,1,3H2,(H4,7,8,9);3,9H,1-2H2,(H4,5,6,7);3*1,3-4H2,2H3;/b;8-3+;;;; |
| InChIKey | CJWMQXIUVKBTJA-HNTQHGQUSA-N |
| XLogP | 2.66 |
| TPSA | 187.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|