C18H36N4OSn — CID 140619507
2-[2-(5-tributylstannyl-1,2-oxazol-3-yl)ethyl]guanidine (PubChem CID 140619507) has the molecular formula C18H36N4OSn and a molecular weight of 443.22 g/mol. Its IUPAC name is 2-[2-(5-tributylstannyl-1,2-oxazol-3-yl)ethyl]guanidine.
| Compound Name | 2-[2-(5-tributylstannyl-1,2-oxazol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 140619507 |
| Molecular Formula | C18H36N4OSn |
| Molecular Weight | 443.22 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 2-[2-(5-tributylstannyl-1,2-oxazol-3-yl)ethyl]guanidine |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc(CCN=C(N)N)no1 |
| InChI | InChI=1S/C6H9N4O.3C4H9.Sn/c7-6(8)9-3-1-5-2-4-11-10-5;3*1-3-4-2;/h2H,1,3H2,(H4,7,8,9);3*1,3-4H2,2H3; |
| InChIKey | AQPQZYITXGSQAP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|