About tert-butyl N-[(Z)-1-trimethylsilylhex-1-yn-3-ylideneamino]carbamate;carbon dioxide
tert-butyl N-[(Z)-1-trimethylsilylhex-1-yn-3-ylideneamino]carbamate;carbon dioxide (PubChem CID 172923396) has the molecular formula C15H26N2O4Si
and a molecular weight of 326.47 g/mol. Its IUPAC name is tert-butyl N-[(Z)-1-trimethylsilylhex-1-yn-3-ylideneamino]carbamate;carbon dioxide.
Molecular Properties
| Compound Name | tert-butyl N-[(Z)-1-trimethylsilylhex-1-yn-3-ylideneamino]carbamate;carbon dioxide |
| PubChem CID | 172923396 |
| Molecular Formula | C15H26N2O4Si |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | tert-butyl N-[(Z)-1-trimethylsilylhex-1-yn-3-ylideneamino]carbamate;carbon dioxide |
| SMILES | CCC/C(C#C[Si](C)(C)C)=N/NC(=O)OC(C)(C)C.O=C=O |
| InChI | InChI=1S/C14H26N2O2Si.CO2/c1-8-9-12(10-11-19(5,6)7)15-16-13(17)18-14(2,3)4;2-1-3/h8-9H2,1-7H3,(H,16,17);/b15-12-; |
| InChIKey | KIYYRQYJSNUNBW-OBBOLZQKSA-N |
| XLogP | 2.96 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(Z)-1-trimethylsilylhex-1-yn-3-ylideneamino]carbamate;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(Z)-1-trimethylsilylhex-1-yn-3-ylideneamino]carbamate;carbon dioxide?
The IUPAC name of tert-butyl N-[(Z)-1-trimethylsilylhex-1-yn-3-ylideneamino]carbamate;carbon dioxide (CID 172923396) is tert-butyl N-[(Z)-1-trimethylsilylhex-1-yn-3-ylideneamino]carbamate;carbon dioxide.
What is the SMILES notation for tert-butyl N-[(Z)-1-trimethylsilylhex-1-yn-3-ylideneamino]carbamate;carbon dioxide?
The canonical SMILES for tert-butyl N-[(Z)-1-trimethylsilylhex-1-yn-3-ylideneamino]carbamate;carbon dioxide is CCC/C(C#C[Si](C)(C)C)=N/NC(=O)OC(C)(C)C.O=C=O.
What is the InChIKey of tert-butyl N-[(Z)-1-trimethylsilylhex-1-yn-3-ylideneamino]carbamate;carbon dioxide?
The InChIKey is KIYYRQYJSNUNBW-OBBOLZQKSA-N. The full InChI is InChI=1S/C14H26N2O2Si.CO2/c1-8-9-12(10-11-19(5,6)7)15-16-13(17)18-14(2,3)4;2-1-3/h8-9H2,1-7H3,(H,16,17);/b15-12-;.
What are the key properties of tert-butyl N-[(Z)-1-trimethylsilylhex-1-yn-3-ylideneamino]carbamate;carbon dioxide?
tert-butyl N-[(Z)-1-trimethylsilylhex-1-yn-3-ylideneamino]carbamate;carbon dioxide has a molecular weight of 326.47 g/mol, XLogP of 2.96, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(Z)-1-trimethylsilylhex-1-yn-3-ylideneamino]carbamate;carbon dioxide is sourced from PubChem (CID 172923396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).