C20H37N3O5S — CID 172961212
1-amino-3-methylbutan-2-one;N'-hydroxy-2-methylpropanimidamide;2-methylpropyl 4-methylbenzenesulfonate (PubChem CID 172961212) has the molecular formula C20H37N3O5S and a molecular weight of 431.60 g/mol. Its IUPAC name is 1-amino-3-methylbutan-2-one;N'-hydroxy-2-methylpropanimidamide;2-methylpropyl 4-methylbenzenesulfonate.
| Compound Name | 1-amino-3-methylbutan-2-one;N'-hydroxy-2-methylpropanimidamide;2-methylpropyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 172961212 |
| Molecular Formula | C20H37N3O5S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 1-amino-3-methylbutan-2-one;N'-hydroxy-2-methylpropanimidamide;2-methylpropyl 4-methylbenzenesulfonate |
| SMILES | CC(C)/C(N)=N\O.CC(C)C(=O)CN.Cc1ccc(S(=O)(=O)OCC(C)C)cc1 |
| InChI | InChI=1S/C11H16O3S.C5H11NO.C4H10N2O/c1-9(2)8-14-15(12,13)11-6-4-10(3)5-7-11;1-4(2)5(7)3-6;1-3(2)4(5)6-7/h4-7,9H,8H2,1-3H3;4H,3,6H2,1-2H3;3,7H,1-2H3,(H2,5,6) |
| InChIKey | FZQLHTVLYDXQPT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|